CAS 203854-47-1
:(3S)-7-[(tert-butoxycarbonyl)amino]-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}heptanoic acid
Description:
The chemical substance known as (3S)-7-[(tert-butoxycarbonyl)amino]-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}heptanoic acid, with CAS number 203854-47-1, is a synthetic amino acid derivative commonly used in peptide synthesis and drug development. This compound features a heptanoic acid backbone, which contributes to its hydrophobic characteristics, while the presence of multiple protecting groups, such as tert-butoxycarbonyl (Boc) and fluorenylmethoxycarbonyl (Fmoc), indicates its utility in the protection of amino groups during peptide synthesis. The stereochemistry at the 3-position is specified as S, which is crucial for its biological activity and interaction with enzymes or receptors. The compound is typically solid at room temperature and may exhibit solubility in organic solvents, depending on the specific conditions. Its structure allows for the formation of peptides with enhanced stability and bioactivity, making it valuable in pharmaceutical research and development. Overall, this compound exemplifies the complexity and versatility of modern synthetic organic chemistry in the context of medicinal applications.
Formula:C27H34N2O6
InChI:InChI=1/C27H34N2O6/c1-27(2,3)35-25(32)28-15-9-8-10-18(16-24(30)31)29-26(33)34-17-23-21-13-6-4-11-19(21)20-12-5-7-14-22(20)23/h4-7,11-14,18,23H,8-10,15-17H2,1-3H3,(H,28,32)(H,29,33)(H,30,31)/t18-/m0/s1
SMILES:CC(C)(C)OC(=NCCCC[C@@H](CC(=O)O)N=C(O)OCC1c2ccccc2c2ccccc12)O
Synonyms:- Heptanoic acid, 7-[[(1,1-dimethylethoxy)carbonyl]amino]-3-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-, (3S)-
- Fmoc-β-HoLys(Boc)-OH
- Fmoc-L-Beta-Homolysine(Boc)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
N(ω)-Boc-N(β)-Fmoc-L-β-homolysine, 95%
CAS:<p>N()-Boc-N(beta)-Fmoc-L-beta-homolysine is used as pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code </p>Formula:C27H34N2O6Purity:95%Molecular weight:482.58Heptanoic acid, 7-[[(1,1-dimethylethoxy)carbonyl]amino]-3-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-, (3S)-
CAS:Formula:C27H34N2O6Purity:98%Color and Shape:SolidMolecular weight:482.5687(3S)-7-[[(1,1-Dimethylethoxy)carbonyl]amino]-3-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]heptanoic acid
CAS:(3S)-7-[[(1,1-Dimethylethoxy)carbonyl]amino]-3-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]heptanoic acidPurity:98%Molecular weight:482.57g/mol(S)-7-tert-Butoxycarbonylamino-3-(9H-fluoren-9-ylmethoxycarbonylamino)-heptanoic acid
CAS:Formula:C27H34N2O6Purity:97%Color and Shape:Solid, White to off-white powderMolecular weight:482.577




