CAS 203854-49-3
:Fmoc-L-beta-homoglutamic acid 6-tert-butyl ester
Description:
Fmoc-L-beta-homoglutamic acid 6-tert-butyl ester is a synthetic amino acid derivative commonly used in peptide synthesis and drug development. It features a fluorenylmethoxycarbonyl (Fmoc) protecting group, which is widely utilized in solid-phase peptide synthesis due to its stability under basic conditions and ease of removal under mild acidic conditions. The compound contains a beta-homoglutamic acid backbone, which contributes to its unique structural properties and potential biological activity. The tert-butyl ester group enhances lipophilicity, improving solubility and stability in organic solvents. This compound is typically characterized by its molecular weight, solubility in various solvents, and specific reactivity patterns, making it valuable in the design of peptides with specific functionalities. Its application extends to the development of pharmaceuticals and bioconjugates, where precise control over amino acid sequences is crucial. As with many synthetic compounds, handling should be done with care, following appropriate safety protocols to mitigate any potential hazards associated with its use.
Formula:C25H29NO6
InChI:InChI=1/C25H29NO6/c1-25(2,3)32-23(29)13-12-16(14-22(27)28)26-24(30)31-15-21-19-10-6-4-8-17(19)18-9-5-7-11-20(18)21/h4-11,16,21H,12-15H2,1-3H3,(H,26,30)(H,27,28)
SMILES:CC(C)(C)OC(=O)CCC(CC(=O)O)N=C(O)OCC1c2ccccc2c2ccccc12
Synonyms:- Fmoc-L-beta-homoglutamic acid(OtBu)
- (3S)-3-(9H-Fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxy]-6-oxohexanoic acid
- (3S)-6-tert-butoxy-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-6-oxohexanoic acid
- 6-tert-butoxy-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-6-oxohexanoic acid
- Fmoc-β-HoGlu(OtBu)-OH
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
N-Fmoc-L-β-homoglutamic acid 6-tert-butyl ester, 95%
CAS:N-Fmoc-L-beta-homoglutamic acid 6-tert-butyl ester is used as organic chemical synthesis intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa AesFormula:C25H29NO6Purity:95%Molecular weight:439.51Hexanedioic acid, 3-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-, 6-(1,1-dimethylethyl) ester, (3S)-
CAS:Formula:C25H29NO6Purity:97%Color and Shape:SolidMolecular weight:439.5009Fmoc-β-HoGlu(OtBu)-OH
CAS:Fmoc-β-HoGlu(OtBu)-OH is an amino acid derivative and has a wide range of applications in life science related research.Formula:C25H28NO6Color and Shape:SolidMolecular weight:438.501fmoc-l-b-Homoglutamic acid (otbu)
CAS:Formula:C25H29NO6Purity:97%Color and Shape:SolidMolecular weight:439.508





