CAS 2039-50-1

5-(Bromomethyl)-3-phenylisoxazole

Description:

5-(Bromomethyl)-3-phenylisoxazole is an organic compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. The presence of a bromomethyl group at the 5-position and a phenyl group at the 3-position contributes to its unique chemical properties. This compound typically appears as a solid and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. Its molecular structure allows for various chemical reactions, including nucleophilic substitutions and electrophilic additions, making it a versatile intermediate in organic synthesis. The compound's reactivity can be influenced by the electron-withdrawing nature of the bromine atom and the electron-donating characteristics of the phenyl group. Additionally, it may exhibit specific physical properties such as solubility in organic solvents, which can vary based on the solvent's polarity. Overall, 5-(Bromomethyl)-3-phenylisoxazole is of interest for its synthetic utility and potential biological activity.

Formula: C₁₀H₈BrNO

InChI: InChI=1S/C10H8BrNO/c11-7-9-6-10(12-13-9)8-4-2-1-3-5-8/h1-6H,7H2

InChI key: InChIKey=ANRMBFFXQKJEIS-UHFFFAOYSA-N

SMILES: C(Br)C1=CC(=NO1)C2=CC=CC=C2

Synonyms:

• 5-(Bromomethyl)-3-phenyl-1,2-oxazole
• Isoxazole, 5-(Bromomethyl)-3-Phenyl-
• 5-(Bromomethyl)-3-phenylisoxazole

5-(Bromomethyl)-3-phenylisoxazole

CAS: 2039-50-1

Formula: C₁₀H₈BrNO

Color and Shape: Solid

Molecular weight: 238.0806

Ref: IN-DA00296J

5-(Bromomethyl)-3-phenylisoxazole

CAS: 2039-50-1

5-(Bromomethyl)-3-phenylisoxazole

Purity: 95%

Molecular weight: 238.08g/mol

Ref: 54-OR12434

5-Bromomethyl-3-phenyl-isoxazole

CAS: 2039-50-1

Formula: C₁₀H₈BrNO

Purity: 95.0%

Molecular weight: 238.084

Ref: 10-F317368

5-(Bromomethyl)-3-phenylisoxazole

CAS: 2039-50-1

5-(Bromomethyl)-3-phenylisoxazole is a methoxy-bromo analog of fluoroquinolones. It has the same mode of action as fluoroquinolones, binding to DNA and inhibiting bacterial topoisomerases (DNA gyrase and topoisomerase IV). The affinity of 5-(Bromomethyl)-3-phenylisoxazole for these enzymes is greater than that of the parent compound, which may account for its increased potency. 5-(Bromomethyl)-3-phenylisoxazole is synthesized by reacting biphenyl with a mixture of bromoethane and methyl iodide in an organic solvent.

Formula: C₁₀H₈BrNO

Purity: Min. 95%

Molecular weight: 238.08 g/mol

Ref: 3D-FB150910