CAS 20401-88-1

3-(4-Methoxyphenyl)propanal

Description:

3-(4-Methoxyphenyl)propanal, also known by its CAS number 20401-88-1, is an organic compound characterized by its aldehyde functional group and a methoxy-substituted phenyl group. This compound features a three-carbon propanal chain attached to a phenyl ring that has a methoxy group (-OCH3) at the para position. The presence of the aldehyde group imparts reactivity typical of aldehydes, including susceptibility to oxidation and participation in condensation reactions. The methoxy group enhances the compound's lipophilicity and can influence its electronic properties, potentially affecting its reactivity and interactions in biological systems. 3-(4-Methoxyphenyl)propanal may be utilized in organic synthesis and could serve as an intermediate in the production of various pharmaceuticals or agrochemicals. Its physical properties, such as boiling point, melting point, and solubility, would depend on the specific molecular interactions and the presence of functional groups. As with many organic compounds, safety precautions should be observed when handling this substance due to its potential reactivity and toxicity.

Formula: C₁₀H₁₂O₂

InChI: InChI=1/C10H12O2/c1-12-10-6-4-9(5-7-10)3-2-8-11/h4-8H,2-3H2,1H3

SMILES: COc1ccc(CCC=O)cc1

Synonyms:

• 3-(4-Methoxy-phenyl)-propionaldehyde
• Benzenepropanal, 4-methoxy-

Benzenepropanal, 4-methoxy-

CAS: 20401-88-1

Formula: C₁₀H₁₂O₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 164.2011

Ref: IN-DA0029A5

3-(4-Methoxyphenyl)Propanal

CAS: 20401-88-1

3-(4-Methoxyphenyl)Propanal

Purity: 98%

Molecular weight: 164.20g/mol

Ref: 54-OR1010670

3-(4-Methoxyphenyl)propionaldehyde

CAS: 20401-88-1

Formula: C₁₀H₁₂O₂

Purity: 95%

Molecular weight: 164.204

Ref: 10-F208248

3-(4-Methoxyphenyl)propionaldehyde

CAS: 20401-88-1

3-(4-Methoxyphenyl)propionaldehyde is an enantioselective compound that can be synthesized in four steps from trichloroacetimidate and d-proline. This compound has been shown to be efficient for the olefination of aldehydes with allylic alcohols. The reaction is catalyzed by Cu(OAc)2, which is used as a catalyst to promote the reaction between the aldehyde and the allylic alcohol, leading to the formation of acetic acid esters.

Formula: C₁₀H₁₂O₂

Purity: Min. 95%

Molecular weight: 164.2 g/mol

Ref: 3D-VAA40188