CAS 2041-56-7

[1-(aminomethyl)cyclobutyl]methanol

Description:

[1-(Aminomethyl)cyclobutyl]methanol, with the CAS number 2041-56-7, is an organic compound characterized by its unique cyclobutane ring structure, which is substituted with an aminomethyl group and a hydroxymethyl group. This compound features a four-membered cyclobutane ring, which contributes to its rigidity and strain, influencing its reactivity and physical properties. The presence of the amino group (-NH2) allows for potential hydrogen bonding and increases its solubility in polar solvents, while the hydroxymethyl group (-CH2OH) can participate in various chemical reactions, including oxidation and esterification. The compound is likely to exhibit basic properties due to the amino group, making it a potential candidate for various applications in organic synthesis, pharmaceuticals, and materials science. Its structural characteristics may also lead to interesting conformational behavior, affecting its interaction with biological systems or other chemical entities. Overall, [1-(aminomethyl)cyclobutyl]methanol is a versatile compound with potential utility in diverse chemical contexts.

Formula: C₆H₁₃NO

InChI: InChI=1/C6H13NO/c7-4-6(5-8)2-1-3-6/h8H,1-5,7H2

SMILES: C1CC(C1)(CN)CO

Synonyms:

• Cyclobutanemethanol, 1-(Aminomethyl)-

(1-(Aminomethyl)cyclobutyl)methanol

CAS: 2041-56-7

Formula: C₆H₁₃NO

Purity: 95%

Color and Shape: Liquid

Molecular weight: 115.1735

Ref: IN-DA0039VB

(1-(Aminomethyl)cyclobutyl)methanol

CAS: 2041-56-7

(1-(Aminomethyl)cyclobutyl)methanol

Purity: 98%

Molecular weight: 115.17g/mol

Ref: 54-OR317108

(1-(Aminomethyl)cyclobutyl)methanol

CAS: 2041-56-7

Formula: C₆H₁₃NO

Purity: 95%

Color and Shape: Liquid

Molecular weight: 115.176

Ref: 10-F239379