CAS 20410-87-1

Anabasamine

Description:

Anabasamine is a chemical compound classified as an alkaloid, primarily derived from the plant species Anabasine, which is found in certain tobacco plants. It is known for its structural similarity to nicotine, sharing a pyridine ring and a piperidine moiety. Anabasamine exhibits neuropharmacological properties, influencing neurotransmitter systems, particularly those related to acetylcholine and dopamine. Its potential effects on the central nervous system have garnered interest in pharmacological research, particularly concerning its role in modulating behavior and cognition. The compound is characterized by its basicity, which allows it to form salts with acids, and it is typically studied in the context of its biological activity and potential therapeutic applications. However, detailed studies on its toxicity, pharmacokinetics, and long-term effects are limited, necessitating further research to fully understand its implications in both medicinal chemistry and toxicology. As with many alkaloids, caution is advised when handling Anabasamine due to its bioactive nature.

Formula: C₁₆H₁₉N₃

InChI: InChI=1/C16H19N3/c1-19-10-3-2-6-16(19)14-7-8-15(18-12-14)13-5-4-9-17-11-13/h4-5,7-9,11-12,16H,2-3,6,10H2,1H3

InChI key: InChIKey=TZRDBHMKTWECOV-UHFFFAOYNA-N

SMILES: CN1C(CCCC1)C=2C=CC(=NC2)C=3C=CC=NC3

Synonyms:

• (+)-5-(1-Methyl-2-piperidinyl)-2,3′-bipyridine
• Anabasamine
• 2,3′-Bipyridine, 5-(1-methyl-2-piperidinyl)-, (+)-
• Anabasamine, (+)-
• (+)-Anabasamine

Anabasamine

CAS: 20410-87-1

Anabasamine is an alkaloid compound that is derived from the plant species Nicotiana glauca, commonly known as tree tobacco. This alkaloid is extracted from the leaves of the plant and exhibits bioactive properties that contribute to its function. Anabasamine interacts primarily with nicotinic acetylcholine receptors (nAChRs), modulating neuronal signaling pathways. Its mode of action involves binding to these receptors, which are ligand-gated ion channels, influencing neurotransmitter release and synaptic transmission.

Formula: C₁₆H₁₉N₃

Purity: Min. 95%

Molecular weight: 253.34 g/mol

Ref: 3D-VAA41087

Anabasamine

CAS: 20410-87-1

Anabasamine is a lupinine alkaloid.

Formula: C₁₆H₁₉N₃

Color and Shape: Solid

Molecular weight: 253.34

Ref: TM-T30046