CAS 204203-14-5

2,6-Bis[1-(2,6-di-i-propylphenylimino)ethyl]pyridine

Description:

2,6-Bis[1-(2,6-di-i-propylphenylimino)ethyl]pyridine, identified by its CAS number 204203-14-5, is a complex organic compound characterized by its unique structure that includes a pyridine ring and multiple imino groups. This compound typically exhibits properties associated with coordination chemistry, often acting as a ligand in metal complexes due to the presence of nitrogen atoms in the imino groups. Its bulky di-i-propylphenyl substituents contribute to steric hindrance, which can influence its reactivity and solubility in various solvents. The compound may display interesting electronic properties, making it suitable for applications in catalysis or materials science. Additionally, its synthesis often involves multi-step organic reactions, highlighting its complexity. As with many organic compounds, its stability and reactivity can be affected by environmental factors such as temperature and pH. Overall, 2,6-Bis[1-(2,6-di-i-propylphenylimino)ethyl]pyridine is a notable example of a ligand with potential applications in coordination chemistry and related fields.

Formula: C₃₃H₄₃N₃

InChI: InChI=1/C33H43N3/c1-20(2)26-14-11-15-27(21(3)4)32(26)34-24(9)30-18-13-19-31(36-30)25(10)35-33-28(22(5)6)16-12-17-29(33)23(7)8/h11-23H,1-10H3

SMILES: CC(C)c1cccc(C(C)C)c1N=C(C)c1cccc(C(=Nc2c(cccc2C(C)C)C(C)C)C)n1

Synonyms:

• N,N'-(2,6-Pyridinediyldi-1-ethyl-1-ylidene)bis(2,6-diisopropylaniline)

2,6-Bis[1-(2,6-di-i-propylphenylimino)ethyl]pyridine

CAS: 204203-14-5

Formula: C₃₃H₄₃N₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 481.7146

Ref: IN-DA01FQZJ

2,6-Bis-[1-(2,6-Diisopropylphenylimino)Ethyl]Pyridine

CAS: 204203-14-5

2,6-Bis-[1-(2,6-Diisopropylphenylimino)Ethyl]Pyridine

Purity: 98%

Molecular weight: 481.71g/mol

Ref: 54-OR1010152

2,6-Bis-[1-(2,6-diisopropylphenylimino)ethyl]pyridine

CAS: 204203-14-5

Purity: 98.0%

Molecular weight: 481.7279968261719

Ref: 10-F547467