CymitQuimica logo

CAS 20421-31-2

:

(3aS,6R,6aR)-6-butyl-3-methylidenetetrahydrofuro[3,4-b]furan-2,4-dione

Description:
The chemical substance known as (3aS,6R,6aR)-6-butyl-3-methylidenetetrahydrofuro[3,4-b]furan-2,4-dione, with the CAS number 20421-31-2, is a complex organic compound characterized by its unique bicyclic structure that incorporates a furan ring. This compound features a butyl group and a methylidene group, contributing to its hydrophobic properties and potential biological activity. The stereochemistry indicated by the (3aS,6R,6aR) notation suggests specific spatial arrangements of its atoms, which can significantly influence its reactivity and interactions with biological systems. The presence of the dione functional groups (two carbonyls) indicates that it may participate in various chemical reactions, such as nucleophilic additions or condensation reactions. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary based on environmental conditions, such as pH and temperature, which are critical for its applications in research and industry.
Formula:C11H14O4
InChI:InChI=1/C11H14O4/c1-3-4-5-7-9-8(11(13)14-7)6(2)10(12)15-9/h7-9H,2-5H2,1H3/t7-,8+,9+/m1/s1
Synonyms:
  • canadensolide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.