CAS 20425-27-8
:(2S,5R,6R)-6-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid
Description:
The chemical substance with the name "(2S,5R,6R)-6-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid" and CAS number "20425-27-8" is a complex bicyclic compound featuring a thiazolidine ring and an isoindole moiety. It is characterized by its specific stereochemistry, indicated by the (2S,5R,6R) configuration, which plays a crucial role in its biological activity and interaction with biological targets. The presence of a carboxylic acid functional group suggests potential acidity and reactivity, while the dioxo and thia groups contribute to its chemical stability and potential for forming hydrogen bonds. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of antibiotics or other therapeutic agents. Its structural complexity and unique functional groups may also influence its solubility, permeability, and overall bioavailability in biological systems.
Formula:C16H14N2O5S
InChI:InChI=1/C16H14N2O5S/c1-16(2)10(15(22)23)18-13(21)9(14(18)24-16)17-11(19)7-5-3-4-6-8(7)12(17)20/h3-6,9-10,14H,1-2H3,(H,22,23)/t9-,10+,14-/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
6β-Phthalimidopenicillanic acid
CAS:<p>6β-Phthalimidopenicillanic acid is an analog of penicillin that acts as an inhibitor of cyclin-dependent kinases (CDKs). It has been shown to have potent anticancer activity and induce apoptosis in tumor cells. This medicinal compound specifically targets CDKs, which are important regulators of the cell cycle and have been implicated in cancer development. 6β-Phthalimidopenicillanic acid has been tested in Chinese hamster ovary cells and human cancer cell lines, where it has demonstrated significant inhibition of CDK activity. This inhibitor also exhibits potential as a protein kinase inhibitor, making it a promising candidate for further development as an anticancer agent.</p>Formula:C16H14N2O5SPurity:Min. 95%Molecular weight:346.4 g/mol
