CAS 204254-63-7
:5-amino-4-methyl-2-nitrobenzoic acid
Description:
5-Amino-4-methyl-2-nitrobenzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with an amino group, a methyl group, and a nitro group. The presence of these functional groups imparts specific chemical properties to the compound. The amino group (-NH2) is a basic functional group that can participate in hydrogen bonding and may influence the compound's solubility in water. The nitro group (-NO2) is a strong electron-withdrawing group, which can affect the reactivity of the compound in electrophilic aromatic substitution reactions. The methyl group (-CH3) serves as a hydrophobic substituent, potentially impacting the compound's overall polarity. This compound is likely to exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid and amino groups. Additionally, it may have applications in pharmaceuticals or as an intermediate in organic synthesis, given its functional diversity. Safety and handling precautions should be observed, as with many nitro compounds, due to potential toxicity and environmental concerns.
Formula:C8H8N2O4
InChI:InChI=1/C8H8N2O4/c1-4-2-7(10(13)14)5(8(11)12)3-6(4)9/h2-3H,9H2,1H3,(H,11,12)
Synonyms:- 5-Amino-4-methyl-2-nitro-benzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
