CAS 204256-39-3

1,2,6,9-tetramethylphenanthrene

Description:

1,2,6,9-Tetramethylphenanthrene is a polycyclic aromatic hydrocarbon (PAH) characterized by its complex structure, which consists of a phenanthrene backbone with four methyl groups attached at the 1, 2, 6, and 9 positions. This compound is typically a solid at room temperature and exhibits a high degree of hydrophobicity due to its extensive aromatic character. It is known for its stability and resistance to degradation, making it relevant in various chemical and environmental studies. The presence of multiple methyl groups enhances its solubility in organic solvents while affecting its physical properties, such as melting and boiling points. 1,2,6,9-Tetramethylphenanthrene is often used in research related to organic electronics, materials science, and as a model compound in studies of PAH behavior in environmental contexts. Its potential biological effects and environmental persistence are also subjects of interest, given the broader implications of PAHs in ecological and health-related studies.

Formula: C₁₈H₁₈

InChI: InChI=1/C18H18/c1-11-5-7-15-13(3)10-17-14(4)12(2)6-8-16(17)18(15)9-11/h5-10H,1-4H3

SMILES: Cc1ccc2c(C)cc3c(C)c(C)ccc3c2c1

Synonyms:

• Phenanthrene, 1,2,6,9-Tetramethyl-

Phenanthrene, 1,2,6,9-tetramethyl-

CAS: 204256-39-3

Formula: C₁₈H₁₈

Molecular weight: 234.3355

Ref: IN-DA0029D0

1,2,6,9-Tetramethyl-phenanthrene

Controlled Product

CAS: 204256-39-3

Applications 1,2,6,9-Tetramethyl-phenanthrene is a persistent organic pollutant (POP).
References Bratberg, M., et al.: Chemosphere, 90, 2157 (2013)

Formula: C₁₈H₁₈

Color and Shape: Neat

Molecular weight: 234.335

Ref: TR-T303740