CAS 204259-66-5

1-Bromododecane-d25

Description:

1-Bromododecane-d25 is a deuterated alkyl bromide, specifically a brominated derivative of dodecane, where the hydrogen atoms in the dodecane chain are partially replaced by deuterium, a stable isotope of hydrogen. This compound is characterized by its long carbon chain, consisting of twelve carbon atoms, which contributes to its hydrophobic nature and relatively low solubility in water. The presence of the bromine atom introduces a polar functional group, making it more reactive than its non-brominated counterparts. The deuteration allows for applications in nuclear magnetic resonance (NMR) spectroscopy, as it provides a means to trace and study molecular interactions without interference from hydrogen signals. 1-Bromododecane-d25 is typically used in organic synthesis, as a reagent in chemical reactions, and in studies involving lipid membranes or surfactants. Its physical properties, such as boiling point and density, are influenced by both the length of the carbon chain and the presence of the bromine atom, making it a useful compound in various chemical research applications.

Formula: C₁₂D₂₅Br

InChI: InChI=1/C12H25Br/c1-2-3-4-5-6-7-8-9-10-11-12-13/h2-12H2,1H3/i1D3,2D2,3D2,4D2,5D2,6D2,7D2,8D2,9D2,10D2,11D2,12D2

SMILES: C(C(C(C(C(C(C(C(C(C(C(C(Br)([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])([2H])[2H]

Synonyms:

• 1-bromo(2H25)dodecane

1-Bromododecane-d25

CAS: 204259-66-5

Formula: CD₃(CD₂)₁₁Br

Purity: 98 atom % D

Color and Shape: Colorless-Pale Yellow Liquid

Molecular weight: 273.27088

Ref: 3U-D3979

1-Bromododecane-d25

Controlled Product

CAS: 204259-66-5

Applications 1-Bromododecane-d25 (CAS# 204259-66-5) is a useful isotopically labeled research compound.

Formula: C₁₂D₂₅Br

Color and Shape: Neat

Molecular weight: 274.39

Ref: TR-B686549