CAS 204316-32-5: Fmoc-Dab(Aloc)-OH
Description:Fmoc-Dab(Aloc)-OH, with the CAS number 204316-32-5, is a chemical compound commonly used in peptide synthesis and drug development. It features a protected amino acid structure, where Fmoc (9-fluorenylmethoxycarbonyl) serves as a protective group for the amine functionality, allowing for selective reactions during peptide assembly. The Dab (Diaminobutyric acid) component introduces a secondary amine, which can participate in various coupling reactions. The Aloc (allyloxycarbonyl) group is another protective moiety that can be selectively removed under specific conditions, facilitating the synthesis of complex peptides. This compound is typically characterized by its stability under standard laboratory conditions, solubility in organic solvents, and reactivity in coupling reactions. Its use in solid-phase peptide synthesis highlights its importance in the field of medicinal chemistry, particularly for the development of peptide-based therapeutics. Overall, Fmoc-Dab(Aloc)-OH is a versatile building block in the synthesis of bioactive peptides, contributing to advancements in pharmaceutical research.
Formula:C23H24N2O6
InChI:InChI=1/C23H24N2O6/c1-2-13-30-22(28)24-12-11-20(21(26)27)25-23(29)31-14-19-17-9-5-3-7-15(17)16-8-4-6-10-18(16)19/h2-10,19-20H,1,11-14H2,(H,24,28)(H,25,29)(H,26,27)/t20-/m0/s1
- Synonyms:
- Fmoc-4-allyloxycarbonyl-L-2,4- diaminobutyric acid
- Fmoc-Dab(Alloc)-OH
- Fmoc-Dab(Alloc)
- (2S)-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-4-{[(prop-2-en-1-yloxy)carbonyl]amino}butanoic acid