CAS 204376-55-6
:9H-fluoren-9-ylmethyl 4-oxopiperidine-1-carboxylate
Description:
9H-fluoren-9-ylmethyl 4-oxopiperidine-1-carboxylate, with the CAS number 204376-55-6, is a chemical compound that features a piperidine ring substituted with a carboxylate group and a ketone functionality. This compound is characterized by its unique structure, which includes a fluorenylmethyl moiety that contributes to its stability and potential for various chemical reactions. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the piperidine ring suggests potential biological activity, as piperidine derivatives are often explored for their pharmacological properties. Additionally, the compound may participate in various chemical reactions, such as esterification or nucleophilic substitutions, due to the reactive functional groups present. Its applications could span across medicinal chemistry, particularly in the development of new therapeutic agents, as well as in synthetic organic chemistry for building more complex molecular architectures. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards.
Formula:C20H19NO3
InChI:InChI=1/C20H19NO3/c22-14-9-11-21(12-10-14)20(23)24-13-19-17-7-3-1-5-15(17)16-6-2-4-8-18(16)19/h1-8,19H,9-13H2
SMILES:c1ccc2c(c1)c1ccccc1C2COC(=O)N1CCC(=O)CC1
Synonyms:- Fmoc-4-piperidone
- 1-Fmoc-4-Piperidone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
N-Fmoc-4-Piperidinone
CAS:N-Fmoc-4-PiperidinonePurity:97%Color and Shape:SolidMolecular weight:321.37g/molN-[(9H-Fluoren-9-ylmethoxy)carbonyl]-4-piperidone
CAS:Formula:C20H19NO3Purity:>98.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:321.38Fmoc-4-piperidone
CAS:Controlled Product<p>Fmoc-4-piperidone is a chemical compound that is used in analytical chemistry. It has the properties of being non-toxic and soluble in organic solvents. Fmoc-4-piperidone can be used as a matrix for the analysis of proteins, peptides, and amino acids with mass spectrometry. The compound also has the capability to desorb and ionize compounds from surfaces using laser desorption/ionization mass spectrometry.</p>Formula:C20H19NO3Purity:Min. 95%Molecular weight:321.37 g/mol1-Piperidinecarboxylic acid, 4-oxo-, 9H-fluoren-9-ylmethyl ester
CAS:Formula:C20H19NO3Purity:97%Color and Shape:SolidMolecular weight:321.3698Ref: IN-DA0029FT
Discontinued product




