CAS 204377-88-8

8-bromo-2,3-dihydro-4H-chromen-4-one

Description:

8-Bromo-2,3-dihydro-4H-chromen-4-one is a chemical compound characterized by its chromenone structure, which features a fused benzene and a carbonyl-containing heterocyclic ring. The presence of a bromine atom at the 8-position contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound typically exhibits a yellow to orange color and is soluble in organic solvents, such as ethanol and dimethyl sulfoxide, but may have limited solubility in water. Its molecular structure allows for various functional group transformations, making it a valuable intermediate in the synthesis of more complex molecules. Additionally, compounds of this class may exhibit biological activities, including antimicrobial or anticancer properties, although specific biological data for this compound may vary. As with many brominated compounds, it is essential to handle 8-bromo-2,3-dihydro-4H-chromen-4-one with care due to potential toxicity and environmental concerns associated with bromine-containing substances.

Formula: C₉H₇BrO₂

InChI: InChI=1/C9H7BrO2/c10-7-3-1-2-6-8(11)4-5-12-9(6)7/h1-3H,4-5H2

SMILES: c1cc2C(=O)CCOc2c(c1)Br

Synonyms:

• 4H-1-benzopyran-4-one, 8-bromo-2,3-dihydro-
• 8-Bromo-4-chromanone
• 8-Bromo-2,3-dihydro-4H-chromen-4-one

4H-1-Benzopyran-4-one, 8-bromo-2,3-dihydro-

CAS: 204377-88-8

Formula: C₉H₇BrO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 227.0547

Ref: IN-DA0029FR

8-Bromochroman-4-one

CAS: 204377-88-8

8-Bromochroman-4-one

Purity: 99%

Molecular weight: 227.05g/mol

Ref: 54-OR90107

8-Bromochroman-4-one

CAS: 204377-88-8

Formula: C₉H₇BrO₂

Purity: 97%

Molecular weight: 227.057

Ref: 10-F227910