CAS 20438-03-3
:Isometamidium
Description:
Isometamidium is a chemical compound primarily known for its use as an antiparasitic agent, particularly in veterinary medicine for the treatment of trypanosomiasis in livestock. It belongs to the class of compounds known as diamidines, which are characterized by their two amine groups connected by a carbon chain. Isometamidium exhibits a broad spectrum of activity against various protozoan parasites, particularly those belonging to the genus Trypanosoma. The compound is typically administered as a salt, enhancing its solubility and bioavailability. Its mechanism of action involves interference with the nucleic acid metabolism of the parasites, leading to their inhibition and eventual death. Isometamidium is known for its relatively low toxicity to mammals, making it a preferred choice in veterinary applications. However, its use is regulated due to potential environmental impacts and the development of resistance in target parasites. Proper handling and adherence to safety guidelines are essential when working with this compound in both clinical and research settings.
Formula:C29H29N7O3S
InChI:InChI=1/C28H25N7.CH4O3S/c1-2-35-26-16-20(29)11-13-24(26)23-14-12-22(17-25(23)27(35)18-7-4-3-5-8-18)33-34-32-21-10-6-9-19(15-21)28(30)31;1-5(2,3)4/h3-17,29H,2H2,1H3,(H4,30,31,32,33);1H3,(H,2,3,4)
SMILES:CC[n+]1c2cc(ccc2c2ccc(cc2c1c1ccccc1)NN=Nc1cccc(c1)C(=N)N)N.CS(=O)(=O)[O-]
Synonyms:- 3-amino-8-[(1E)-3-(3-carbamimidoylphenyl)triaz-1-en-1-yl]-5-ethyl-6-phenylphenanthridinium
- 3-amino-8-[(1E)-3-(3-carbamimidoylphenyl)triaz-1-en-1-yl]-5-ethyl-6-phenylphenanthridinium chloride hydrochloride (1:1:1)
- 3-amino-8-[(1E)-3-(3-carbamimidoylphenyl)triaz-1-en-1-yl]-5-ethyl-6-phenylphenanthridinium methanesulfonate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ref: 4Z-I-086002
Discontinued product
