CymitQuimica logo

CAS 204388-70-5

:

1-oxa-6-azaspiro[3.5]nonane

Description:
1-Oxa-6-azaspiro[3.5]nonane is a bicyclic organic compound characterized by its unique spiro structure, which consists of a nitrogen atom and an oxygen atom incorporated into its framework. The compound features a spirocyclic arrangement, where two rings share a single atom, contributing to its distinctive three-dimensional shape. This structure can influence its chemical reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of both nitrogen and oxygen atoms in the ring system may impart specific polar characteristics, affecting solubility and interaction with biological targets. Additionally, the compound's molecular geometry can lead to interesting conformational properties, which are crucial for its biological activity. As with many nitrogen-containing heterocycles, 1-oxa-6-azaspiro[3.5]nonane may exhibit interesting pharmacological properties, making it a subject of interest in drug discovery and development. However, detailed studies on its specific properties, reactivity, and applications would be necessary to fully understand its potential uses in various fields.
Formula:C7H13NO
InChI:InChI=1/C7H13NO/c1-2-7(3-5-9-7)6-8-4-1/h8H,1-6H2
InChI key:ORIDQWJOJCVWHY-UHFFFAOYSA-N
SMILES:C1CC2(CCO2)CNC1
Synonyms:
  • 1-Oxa-6-azaspiro[3.5]nonan
Found 4 products.