CAS 204394-62-7

4-Chloro-5,6-dimethyl-2-(4-pyridinyl)pyrimidine

Description:

4-Chloro-5,6-dimethyl-2-(4-pyridinyl)pyrimidine is a heterocyclic organic compound characterized by its pyrimidine core, which is a six-membered ring containing two nitrogen atoms at positions 1 and 3. The presence of a chloro group at position 4 and two methyl groups at positions 5 and 6 contributes to its unique chemical properties. Additionally, the compound features a pyridine substituent at position 2, which enhances its potential for biological activity and interactions with various receptors or enzymes. This compound is typically solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The presence of halogen and nitrogen functionalities often influences its reactivity and interaction with other chemical species. As with many heterocycles, it may also exhibit interesting electronic properties, making it a subject of interest in materials science and organic synthesis.

Formula: C₁₁H₁₀ClN₃

InChI: InChI=1S/C11H10ClN3/c1-7-8(2)14-11(15-10(7)12)9-3-5-13-6-4-9/h3-6H,1-2H3

InChI key: InChIKey=SVJUNAJRFDNUHF-UHFFFAOYSA-N

SMILES: CC1=NC(=NC(Cl)=C1C)C=2C=CN=CC2

Synonyms:

• 4-Chloro-5,6-dimethyl-2-(4-pyridinyl)pyrimidine
• Pyrimidine, 4-chloro-5,6-dimethyl-2-(4-pyridinyl)-

4-Chloro-5,6-dimethyl-2-(pyridin-4-yl)pyrimidine

CAS: 204394-62-7

Versatile small molecule scaffold

Formula: C₁₁H₁₀ClN₃

Purity: Min. 95%

Molecular weight: 219.67 g/mol

Ref: 3D-EIA39462