
CAS 2044-27-1
:1-Methyl-2(1H)-pyridinethione
Description:
1-Methyl-2(1H)-pyridinethione, with the CAS number 2044-27-1, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a methyl group attached to the nitrogen of the pyridine and a thione functional group, which is a sulfur-containing analogue of a ketone. The presence of the thione group imparts unique chemical reactivity, particularly in nucleophilic and electrophilic reactions. 1-Methyl-2(1H)-pyridinethione is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its applications can be found in various fields, including organic synthesis and as a potential ligand in coordination chemistry. The compound's properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions. As with many sulfur-containing compounds, it may exhibit distinct odors and should be handled with care due to potential toxicity.
Formula:C6H7NS
InChI:InChI=1S/C6H7NS/c1-7-5-3-2-4-6(7)8/h2-5H,1H3
InChI key:InChIKey=UHOAUPKGWPQNDM-UHFFFAOYSA-N
SMILES:S=C1N(C)C=CC=C1
Synonyms:- 1-Methyl-2-thiopyridone
- 1-Methyl-2(1H)-pyridinethione
- N-Methyl-2-pyridinethione
- 2(1H)-Pyridinethione, 1-methyl-
- 1-Methyl-2-pyridinethione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

