CAS 2044704-74-5

4-[5-(4-Pyridinyl)-1,3,4-oxadiazol-2-yl]-2-pyridinecarbonitrile

Description:

4-[5-(4-Pyridinyl)-1,3,4-oxadiazol-2-yl]-2-pyridinecarbonitrile is a chemical compound characterized by its complex structure, which includes a pyridine ring and an oxadiazole moiety. This compound features a pyridinecarbonitrile group, indicating the presence of a cyano group (-C≡N) attached to a pyridine ring, which contributes to its potential reactivity and biological activity. The oxadiazole ring, a five-membered heterocyclic compound containing nitrogen and oxygen, is known for its diverse applications in pharmaceuticals and agrochemicals due to its ability to participate in various chemical reactions. The presence of multiple heteroatoms in the structure enhances its solubility and interaction with biological targets. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its specific characteristics, such as melting point, solubility, and spectral data, would typically be determined through experimental methods and are essential for understanding its behavior in different environments.

Formula: C₁₃H₇N₅O

InChI: InChI=1S/C13H7N5O/c14-8-11-7-10(3-6-16-11)13-18-17-12(19-13)9-1-4-15-5-2-9/h1-7H

InChI key: InChIKey=SDJAUDWOPBSBII-UHFFFAOYSA-N

SMILES: C(#N)C1=CC(C=2OC(=NN2)C=3C=CN=CC3)=CC=N1

Synonyms:

• 4-[5-(4-Pyridinyl)-1,3,4-oxadiazol-2-yl]-2-pyridinecarbonitrile
• 2-Pyridinecarbonitrile, 4-[5-(4-pyridinyl)-1,3,4-oxadiazol-2-yl]-

Topiroxostat Impurity C

CAS: 2044704-74-5

Formula: C₁₃H₇N₅O

Molecular weight: 249.23

Ref: 4Z-T-148015

4-(5-Pyridin-4-yl-1,3,4-oxadiazol-2-yl)pyridine-2-carbonitrile

CAS: 2044704-74-5

4-(5-Pyridin-4-yl-1,3,4-oxadiazol-2-yl)pyridine-2-carbonitrile is a potent and selective inhibitor of the human peptidylprolyl isomerase B (PPIB), which is a key enzyme in protein folding. 4-(5-Pyridin-4-yl-1,3,4-oxadiazol-2-yl)pyridine - 2 - carbonitrile has been used as a research tool for studying PPIB's function in the cell. It has also shown to be an activator of the A2A receptor and ligand for the A3 receptor.

Formula: C₁₃H₇N₅O

Purity: Min. 95%

Molecular weight: 249.23 g/mol

Ref: 3D-UGD70474

Topiroxostat Impurity C

CAS: 2044704-74-5

Formula: C₁₃H₇N₅O

Molecular weight: 249.23

Ref: ST-EA-CP-T170032