CAS 2044706-58-1
:Ethyl 5-isoquinolinesulfonate
Description:
Ethyl 5-isoquinolinesulfonate is a chemical compound characterized by its isoquinoline structure, which is a bicyclic compound containing a benzene ring fused to a pyridine ring. This compound features a sulfonate group, which enhances its solubility in polar solvents and can influence its reactivity and biological activity. Ethyl 5-isoquinolinesulfonate is typically used in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals or biologically active compounds. Its sulfonate group can also impart unique properties, such as increased stability and the ability to participate in nucleophilic substitution reactions. The compound's molecular structure contributes to its potential applications in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways. As with many chemical substances, safety data and handling precautions should be observed, as the compound may exhibit toxicity or other hazardous properties.
Formula:C11H11NO3S
InChI:InChI=1S/C11H11NO3S/c1-2-15-16(13,14)11-5-3-4-9-8-12-7-6-10(9)11/h3-8H,2H2,1H3
InChI key:InChIKey=KUKJMBWADIRIMT-UHFFFAOYSA-N
SMILES:S(OCC)(=O)(=O)C=1C2=C(C=CC1)C=NC=C2
Synonyms:- 5-Isoquinolinesulfonic acid, ethyl ester
- Ethyl 5-isoquinolinesulfonate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
