CAS 2044707-02-8

Hydrazine, [(2-chloro-4-fluorophenyl)methyl]-, hydrochloride (1:2)

Description:

Hydrazine, [(2-chloro-4-fluorophenyl)methyl]-, hydrochloride (1:2) is a chemical compound characterized by its hydrazine backbone, which is a class of compounds known for their high reactivity and use as reducing agents. This specific compound features a chloro and fluorine substitution on a phenyl ring, which can influence its chemical properties, such as solubility and reactivity. The hydrochloride form indicates that the compound is a salt, typically enhancing its stability and solubility in water. The presence of halogen substituents often contributes to the compound's biological activity, making it of interest in pharmaceutical applications. Additionally, hydrazine derivatives are known for their potential use in various chemical syntheses and as intermediates in the production of agrochemicals and pharmaceuticals. Safety considerations are paramount when handling hydrazine compounds due to their toxicity and potential for hazardous reactions. Overall, this compound exemplifies the diverse applications and significant properties of halogenated hydrazines in chemical research and industry.

Formula: C₇H₈ClFN₂·2ClH

InChI: InChI=1S/C7H8ClFN2.2ClH/c8-7-3-6(9)2-1-5(7)4-11-10;;/h1-3,11H,4,10H2;2*1H

InChI key: InChIKey=SSLRKYMUVWOICP-UHFFFAOYSA-N

SMILES: C(NN)C1=C(Cl)C=C(F)C=C1.Cl

Synonyms:

• Hydrazine, [(2-chloro-4-fluorophenyl)methyl]-, hydrochloride (1:2)

(2-Chloro-4-fluorobenzyl)hydrazine dihydrochloride

CAS: 2044707-02-8

Formula: C₇H₁₀Cl₃FN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 247.5251

Ref: IN-DA0029IE

[(2-chloro-4-fluorophenyl)methyl]hydrazine dihydrochloride

CAS: 2044707-02-8

[(2-chloro-4-fluorophenyl)methyl]hydrazine dihydrochloride

Purity: 97%

Molecular weight: 247.53g/mol

Ref: 54-PC1004357

[(2-chloro-4-fluorophenyl)methyl]hydrazine dihydrochloride

CAS: 2044707-02-8

Formula: C₇H₁₀Cl₃FN₂

Purity: 97%

Molecular weight: 247.52

Ref: 10-F519063