CAS 2044707-11-9

Hydrazine, [(4-nitrophenyl)methyl]-, hydrochloride (1:2)

Description:

Hydrazine, [(4-nitrophenyl)methyl]-, hydrochloride (1:2) is a chemical compound characterized by its hydrazine backbone, which is modified by the presence of a 4-nitrophenylmethyl group. This compound typically appears as a crystalline solid and is soluble in water due to the hydrochloride form, which enhances its solubility through the formation of ions in solution. The presence of the nitrophenyl group imparts specific electronic properties, making it potentially useful in various chemical reactions, including those involving nucleophilic substitutions. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. In terms of safety, hydrazine derivatives can be hazardous, exhibiting toxicity and potential carcinogenicity, necessitating careful handling and appropriate safety measures in laboratory settings. Its applications may extend to fields such as pharmaceuticals, agrochemicals, and materials science, where its unique reactivity can be harnessed for synthesis and development purposes.

Formula: C₇H₉N₃O₂·2ClH

InChI: InChI=1S/C7H9N3O2.2ClH/c8-9-5-6-1-3-7(4-2-6)10(11)12;;/h1-4,9H,5,8H2;2*1H

InChI key: InChIKey=LLNLXWJQLNRMQB-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=CC=C(CNN)C=C1.Cl

Synonyms:

• Hydrazine, [(4-nitrophenyl)methyl]-, hydrochloride (1:2)

[(4-Nitrophenyl)methyl]hydrazine dihydrochloride

CAS: 2044707-11-9

Versatile small molecule scaffold

Formula: C₇H₁₁Cl₂N₃O₂

Purity: Min. 95%

Molecular weight: 240.08 g/mol

Ref: 3D-UGD70711