CAS 2044712-59-4

Cyclohexaneacetic acid, α-(aminomethyl)-, methyl ester, hydrochloride (1:1)

Description:

Cyclohexaneacetic acid, α-(aminomethyl)-, methyl ester, hydrochloride (1:1) is a chemical compound characterized by its structural features that include a cyclohexane ring, an acetic acid moiety, and an amino group. This compound is typically a white to off-white crystalline solid, soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. The presence of the amino group suggests potential basic properties, while the ester functionality indicates reactivity typical of esters, such as hydrolysis. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for various interactions, including hydrogen bonding, which can influence its behavior in biological systems. As with many compounds containing both acidic and basic functional groups, it may exist in different protonation states depending on the pH of the environment. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₁₀H₁₉NO₂·ClH

InChI: InChI=1S/C10H19NO2.ClH/c1-13-10(12)9(7-11)8-5-3-2-4-6-8;/h8-9H,2-7,11H2,1H3;1H

InChI key: InChIKey=IVSZKYYARWFQSL-UHFFFAOYSA-N

SMILES: C(C(OC)=O)(CN)C1CCCCC1.Cl

Synonyms:

• Cyclohexaneacetic acid, α-(aminomethyl)-, methyl ester, hydrochloride (1:1)

Methyl 3-amino-2-cyclohexylpropanoate hydrochloride

CAS: 2044712-59-4

Versatile small molecule scaffold

Formula: C₁₀H₂₀ClNO₂

Purity: Min. 95%

Molecular weight: 221.72 g/mol

Ref: 3D-UGD71259