CAS 2044713-19-9

3-Pyrrolidinol, 3-[[(phenylmethyl)amino]methyl]-, hydrochloride (1:2)

Description:

3-Pyrrolidinol, 3-[[(phenylmethyl)amino]methyl]-, hydrochloride (1:2) is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. The compound features a phenylmethyl group attached to a nitrogen atom, indicating the presence of an aromatic moiety that can influence its chemical reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its utility in pharmaceutical applications. The presence of the hydroxyl group on the pyrrolidine ring suggests potential for hydrogen bonding, impacting its interactions with biological targets. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of drugs targeting the central nervous system or other therapeutic areas. Its specific characteristics, such as melting point, solubility, and biological activity, would depend on the precise molecular interactions and the context of its use in research or clinical settings.

Formula: C₁₂H₁₈N₂O·2ClH

InChI: InChI=1S/C12H18N2O.2ClH/c15-12(6-7-13-9-12)10-14-8-11-4-2-1-3-5-11;;/h1-5,13-15H,6-10H2;2*1H

InChI key: InChIKey=NQLTVXFPIUPUQF-UHFFFAOYSA-N

SMILES: C(NCC1=CC=CC=C1)C2(O)CCNC2.Cl

Synonyms:

• 3-Pyrrolidinol, 3-[[(phenylmethyl)amino]methyl]-, hydrochloride (1:2)

3-[(Benzylamino)methyl]pyrrolidin-3-ol dihydrochloride

CAS: 2044713-19-9

Versatile small molecule scaffold

Formula: C₁₂H₂₀Cl₂N₂O

Purity: Min. 95%

Molecular weight: 279.2 g/mol

Ref: 3D-UGD71319