CAS 2044714-54-5

1,3-Propanediol, 2-amino-1-(4-chlorophenyl)-, hydrochloride (1:1)

Description:

1,3-Propanediol, 2-amino-1-(4-chlorophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its structural features, which include a propanediol backbone with an amino group and a 4-chlorophenyl substituent. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and may influence its biological activity. The presence of the amino group suggests potential for hydrogen bonding, which can affect its interaction with biological targets. The 4-chlorophenyl group may impart specific pharmacological properties, potentially enhancing lipophilicity or altering receptor binding profiles. As a hydrochloride, it is likely to be a white crystalline solid, stable under standard conditions, and may exhibit moderate to high stability in various environments. Its applications could span pharmaceuticals, where it may serve as an intermediate or active ingredient, particularly in the development of therapeutic agents. Safety and handling precautions should be observed, as with any chemical, due to potential toxicity or reactivity.

Formula: C₉H₁₂ClNO₂·ClH

InChI: InChI=1S/C9H12ClNO2.ClH/c10-7-3-1-6(2-4-7)9(13)8(11)5-12;/h1-4,8-9,12-13H,5,11H2;1H

InChI key: InChIKey=FYUVPJRAXNFRLC-UHFFFAOYSA-N

SMILES: C(C(CO)N)(O)C1=CC=C(Cl)C=C1.Cl

Synonyms:

• 1,3-Propanediol, 2-amino-1-(4-chlorophenyl)-, hydrochloride (1:1)

2-Amino-1-(4-chlorophenyl)propane-1,3-diol hydrochloride

CAS: 2044714-54-5

Versatile small molecule scaffold

Formula: C₉H₁₃Cl₂NO₂

Purity: Min. 95%

Molecular weight: 238.11 g/mol

Ref: 3D-UGD71454