CAS 20448-79-7
:2-aminobicyclo[2.2.1]heptane-2-carboxylic acid
Description:
2-Aminobicyclo[2.2.1]heptane-2-carboxylic acid, also known as norbornane-2-carboxylic acid, is a bicyclic compound characterized by its unique bicyclic structure, which consists of a seven-membered ring system. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH) attached to the same carbon atom, making it an amino acid derivative. It is typically a white to off-white solid at room temperature and is soluble in water due to the presence of the carboxylic acid group, which can ionize to form a carboxylate anion. The bicyclic structure contributes to its rigidity and can influence its reactivity and interactions with biological systems. This compound is of interest in various fields, including medicinal chemistry and organic synthesis, due to its potential applications in drug development and as a building block for more complex molecules. Its CAS number, 20448-79-7, is used for identification in chemical databases and regulatory contexts.
Formula:C8H13NO2
InChI:InChI=1/C8H13NO2/c9-8(7(10)11)4-5-1-2-6(8)3-5/h5-6H,1-4,9H2,(H,10,11)
SMILES:C1CC2CC1CC2(C(=O)O)N
Synonyms:- Bicyclo[2.2.1]Heptane-2-Carboxylic Acid, 2-Amino-
- 2-Aminobicyclo[2.2.1]heptane-2-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Bicyclo[2.2.1]heptane-2-carboxylic acid, 2-amino-
CAS:Formula:C8H13NO2Purity:95%Color and Shape:SolidMolecular weight:155.1943LAT1-IN-1
CAS:LAT1-IN-1 (BCH) is a selective and competitive inhibitor of L-type amino acid transporter protein 1 (LAT1). LAT1-IN-1 has antitumor activity. Cost-effective and quality-assured.Formula:C8H13NO2Purity:99.94% - ≥98%Color and Shape:SolidMolecular weight:155.192-Amino-2-norbornanecarboxylic acid
CAS:Formula:C8H13NO2Purity:≥ 97.0%Color and Shape:White to brown powderMolecular weight:155.192-Aminobicyclo[2.2.1]Heptane-2-Carboxylic Acid
CAS:2-Aminobicyclo[2.2.1]Heptane-2-Carboxylic AcidPurity:95%Molecular weight:155.19g/mol2-Amino-2-norbornanecarboxylic Acid
CAS:Controlled ProductApplications 2-Amino-2-norbornanecarboxylic Acid functions in the suppressive effect of I-type amino acid transporter 1 inhibition as therapeutic target on human esophageal squamous cell carcinoma. Also use in the design and preparation of KMH-233, selective and slowly reversible inhibitor of L-type amino acid transporter 1 (LAT1) which potentiates antiproliferative drug efficacy in cancer cells
References Ohshima, Y., et al.: Cancer Science, 107, 1499 (206); Huttunen, K. M., et al.: J. Med. Chem., 59, 5740 (2016)Formula:C8H13NO2Color and Shape:White To Off-WhiteMolecular weight:155.19





