CAS 2044836-37-3

Azetidine, 3-(2-thienylmethyl)-, hydrochloride (1:1)

Description:

Azetidine, 3-(2-thienylmethyl)-, hydrochloride (1:1) is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. The presence of the 2-thienylmethyl group indicates that a thiophene ring is attached to the azetidine at the third position, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, particularly in pharmaceuticals. The compound may exhibit biological activity due to the presence of the thiophene moiety, which is known for its diverse pharmacological properties. Its molecular interactions can be influenced by the azetidine structure, which may affect its reactivity and potential applications in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory settings. Further studies would be necessary to fully elucidate its properties, including its stability, reactivity, and potential therapeutic uses.

Formula: C₈H₁₁NS·ClH

InChI: InChI=1S/C8H11NS.ClH/c1-2-8(10-3-1)4-7-5-9-6-7;/h1-3,7,9H,4-6H2;1H

InChI key: InChIKey=ADQZOAPXORYPTF-UHFFFAOYSA-N

SMILES: C(C1CNC1)C2=CC=CS2.Cl

Synonyms:

• Azetidine, 3-(2-thienylmethyl)-, hydrochloride (1:1)

3-[(Thiophen-2-yl)methyl]azetidine hydrochloride

CAS: 2044836-37-3

Versatile small molecule scaffold

Formula: C₈H₁₂ClNS

Purity: Min. 95%

Molecular weight: 189.71 g/mol

Ref: 3D-UGD83637