CAS 2044836-83-9

Benzoic acid, 3-chloro-4-[[2-(4-morpholinyl)ethyl]amino]-, hydrochloride (1:1)

Description:

Benzoic acid, 3-chloro-4-[[2-(4-morpholinyl)ethyl]amino]-, hydrochloride (1:1) is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety substituted with a chloro group and an amino side chain featuring a morpholine ring. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and may influence its biological activity. The presence of the morpholine group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as morpholine derivatives are often associated with enhanced bioactivity and favorable pharmacokinetic properties. The compound's molecular structure indicates it may exhibit both acidic and basic properties, allowing it to participate in various chemical reactions. Additionally, its specific functional groups may confer unique interactions with biological targets, making it of interest in research related to drug design and development. As with many chemical substances, safety data and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₃H₁₇ClN₂O₃·ClH

InChI: InChI=1S/C13H17ClN2O3.ClH/c14-11-9-10(13(17)18)1-2-12(11)15-3-4-16-5-7-19-8-6-16;/h1-2,9,15H,3-8H2,(H,17,18);1H

InChI key: InChIKey=ITHWVZPRODBZLC-UHFFFAOYSA-N

SMILES: N(CCN1CCOCC1)C2=C(Cl)C=C(C(O)=O)C=C2.Cl

Synonyms:

• Benzoic acid, 3-chloro-4-[[2-(4-morpholinyl)ethyl]amino]-, hydrochloride (1:1)

3-Chloro-4-{[2-(morpholin-4-yl)ethyl]amino}benzoic acid hydrochloride

CAS: 2044836-83-9

Versatile small molecule scaffold

Formula: C₁₃H₁₈Cl₂N₂O₃

Purity: Min. 95%

Molecular weight: 321.2 g/mol

Ref: 3D-UGD83683