CAS 2044871-07-8

Pyrazolo[1,5-a]pyrimidin-3-amine, 4,5,6,7-tetrahydro-6-methyl-, hydrochloride (1:1)

Description:

Pyrazolo[1,5-a]pyrimidin-3-amine, 4,5,6,7-tetrahydro-6-methyl-, hydrochloride (1:1) is a chemical compound characterized by its unique bicyclic structure, which incorporates both pyrazole and pyrimidine moieties. This compound typically appears as a white to off-white solid and is soluble in polar solvents, such as water and methanol, due to the presence of the hydrochloride salt form. The tetrahydro component indicates that it contains a saturated ring system, contributing to its potential biological activity. The presence of the amine functional group suggests that it may engage in hydrogen bonding, enhancing its reactivity and interaction with biological targets. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as it may exhibit various pharmacological properties. Its specific characteristics, such as melting point, boiling point, and spectral data, would be determined through experimental methods and may vary based on purity and environmental conditions.

Formula: C₇H₁₂N₄·ClH

InChI: InChI=1S/C7H12N4.ClH/c1-5-2-9-7-6(8)3-10-11(7)4-5;/h3,5,9H,2,4,8H2,1H3;1H

InChI key: InChIKey=VLLUIFJEOPFNJA-UHFFFAOYSA-N

SMILES: NC1=C2N(N=C1)CC(C)CN2.Cl

Synonyms:

• Pyrazolo[1,5-a]pyrimidin-3-amine, 4,5,6,7-tetrahydro-6-methyl-, hydrochloride (1:1)

6-Methyl-4H,5H,6H,7H-pyrazolo[1,5-a]pyrimidin-3-amine hydrochloride

CAS: 2044871-07-8

Versatile small molecule scaffold

Formula: C₇H₁₃ClN₄

Purity: Min. 95%

Molecular weight: 188.66 g/mol

Ref: 3D-UGD87107