CAS 2044871-61-4

6-Bromo-3-formylimidazo[1,2-a]pyridine-7-carboxylic acid

Description:

6-Bromo-3-formylimidazo[1,2-a]pyridine-7-carboxylic acid is a heterocyclic compound characterized by its imidazo-pyridine structure, which incorporates both a bromine atom and a formyl group. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the bromine atom enhances its reactivity and may influence its biological activity, making it of interest in medicinal chemistry. The imidazo[1,2-a]pyridine framework is known for its potential applications in pharmaceuticals, particularly in the development of compounds with antimicrobial or anticancer properties. The formyl group allows for further functionalization, enabling the synthesis of derivatives that may exhibit varied biological activities. Additionally, the compound's solubility and stability can be influenced by the presence of the carboxylic acid group, which can participate in hydrogen bonding and ionic interactions. Overall, 6-Bromo-3-formylimidazo[1,2-a]pyridine-7-carboxylic acid represents a versatile scaffold for chemical synthesis and biological exploration.

Formula: C₉H₅BrN₂O₃

InChI: InChI=1S/C9H5BrN2O3/c10-7-3-12-5(4-13)2-11-8(12)1-6(7)9(14)15/h1-4H,(H,14,15)

InChI key: InChIKey=SDTHFCXDVVGCHV-UHFFFAOYSA-N

SMILES: C(=O)C=1N2C(C=C(C(O)=O)C(Br)=C2)=NC1

Synonyms:

• Imidazo[1,2-a]pyridine-7-carboxylic acid, 6-bromo-3-formyl-
• 6-Bromo-3-formylimidazo[1,2-a]pyridine-7-carboxylic acid

6-Bromo-3-formylimidazo[1,2-a]pyridine-7-carboxylic acid

CAS: 2044871-61-4

Versatile small molecule scaffold

Formula: C₉H₅BrN₂O₃

Purity: Min. 95%

Molecular weight: 269.05 g/mol

Ref: 3D-UGD87161