CAS 2044927-46-8

Benzenamine, 4-(1-bromoethyl)-N,N-dimethyl-, hydrobromide (1:1)

Description:

Benzenamine, 4-(1-bromoethyl)-N,N-dimethyl-, hydrobromide (1:1) is an organic compound characterized by its amine functional group and a brominated ethyl substituent. The presence of the dimethylamino group indicates that it has two methyl groups attached to the nitrogen atom, enhancing its basicity and potential reactivity. The hydrobromide salt form suggests that the compound is protonated, which can increase its solubility in polar solvents. This compound is likely to exhibit properties typical of amines, such as basicity and nucleophilicity, making it useful in various chemical reactions, including nucleophilic substitutions. The bromine atom introduces a halogen functionality, which can participate in further chemical transformations. Additionally, the aromatic benzene ring contributes to the compound's stability and can influence its electronic properties. Overall, this compound may find applications in organic synthesis, pharmaceuticals, or as an intermediate in the production of other chemical entities. However, specific safety and handling guidelines should be followed due to the presence of bromine and the potential toxicity of amines.

Formula: C₁₀H₁₄BrN·BrH

InChI: InChI=1S/C10H14BrN.BrH/c1-8(11)9-4-6-10(7-5-9)12(2)3;/h4-8H,1-3H3;1H

InChI key: InChIKey=DIBQNOFTYJRUCD-UHFFFAOYSA-N

SMILES: C(Br)(C)C1=CC=C(N(C)C)C=C1.Br

Synonyms:

• Benzenamine, 4-(1-bromoethyl)-N,N-dimethyl-, hydrobromide (1:1)

4-(1-Bromoethyl)-N,N-dimethylaniline hydrobromide

CAS: 2044927-46-8

Versatile small molecule scaffold

Formula: C₁₀H₁₅Br₂N

Purity: Min. 95%

Molecular weight: 309.04 g/mol

Ref: 3D-UGD92746