CAS 204688-60-8

(R)-N-Boc-3-pyrrolidineacetic acid

Description:

(R)-N-Boc-3-pyrrolidineacetic acid is a chiral amino acid derivative characterized by its pyrrolidine ring structure and a Boc (tert-butyloxycarbonyl) protecting group. This compound features a carboxylic acid functional group, which contributes to its acidic properties, and a pyrrolidine moiety that imparts unique steric and electronic characteristics. The presence of the Boc group enhances its stability and solubility, making it suitable for various synthetic applications, particularly in peptide synthesis and medicinal chemistry. As a chiral compound, it can exist in two enantiomeric forms, with the (R)-configuration being of particular interest for its potential biological activity. The compound is typically used in the synthesis of more complex molecules, including pharmaceuticals, due to its ability to introduce chirality into larger structures. Its CAS number, 204688-60-8, allows for easy identification in chemical databases and literature. Overall, (R)-N-Boc-3-pyrrolidineacetic acid is valued for its versatility in organic synthesis and its role in the development of biologically active compounds.

Formula: C₁₁H₁₉NO₄

InChI: InChI=1/C11H19NO4/c1-11(2,3)16-10(15)12-5-4-8(7-12)6-9(13)14/h8H,4-7H2,1-3H3,(H,13,14)/t8-/m1/s1

SMILES: CC(C)(C)OC(=O)N1CC[C@H](CC(=O)O)C1

Synonyms:

• (R)-(1-Boc-Pyrrolidin-3-yl)-acetic acid
• [(3R)-1-(tert-butoxycarbonyl)pyrrolidin-3-yl]acetic acid

3-Pyrrolidineacetic acid, 1-[(1,1-dimethylethoxy)carbonyl]-, (3R)-

CAS: 204688-60-8

Formula: C₁₁H₁₉NO₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 229.2729

Ref: IN-DA0029N7

(R)-(1-BOC-pyrrolidin-3-yl)-acetic acid

CAS: 204688-60-8

(R)-(1-BOC-pyrrolidin-3-yl)-acetic acid

Purity: 98%,99%ee

Molecular weight: 229.27g/mol

Ref: 54-OR313029

(R)-(1-Boc-Pyrrolidin-3-yl)-acetic acid

CAS: 204688-60-8

Formula: C₁₁H₁₉NO₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 229.276

Ref: 10-F034353