CAS 2047-89-4

Indolo(2,3-b)cycloheptene

Description:

Indolo(2,3-b)cycloheptene is a bicyclic compound that features a fused indole and cycloheptene structure. It is characterized by its unique arrangement of carbon and nitrogen atoms, which contributes to its aromatic properties and potential reactivity. The compound typically exhibits a planar structure due to the conjugated pi system, allowing for delocalization of electrons, which can influence its chemical behavior and stability. Indolo(2,3-b)cycloheptene is often studied for its potential applications in organic synthesis and medicinal chemistry, particularly due to the indole moiety, which is prevalent in many biologically active compounds. Its physical properties, such as melting point and solubility, can vary based on the specific conditions and purity of the sample. Additionally, the compound may undergo various chemical reactions, including electrophilic substitutions and cycloadditions, making it of interest for further research in synthetic methodologies. Overall, indolo(2,3-b)cycloheptene represents a fascinating subject within the field of organic chemistry due to its structural complexity and potential utility.

Formula: C₁₃H₁₅N

InChI: InChI=1/C13H15N/c1-2-6-10-11-7-4-5-9-13(11)14-12(10)8-3-1/h4-5,7,9,14H,1-3,6,8H2

SMILES: C1CCc2c3ccccc3[nH]c2CC1

Synonyms:

• 5,6,7,8,9,10-Hexahydrocyclohepta[B]Indole

5,6,7,8,9,10-Hexahydrocyclohept[b]indole, 98%

CAS: 2047-89-4

This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci

Formula: C₁₃H₁₅N

Purity: 98%

Color and Shape: Crystals or powder or crystalline powder, Pale cream

Molecular weight: 185.27

Ref: 02-A19344

Cyclohept[b]indole, 5,6,7,8,9,10-hexahydro-

CAS: 2047-89-4

Formula: C₁₃H₁₅N

Purity: 98%

Color and Shape: Solid

Molecular weight: 185.2649

Ref: IN-DA0029NN

5,6,7,8,9,10-Hexahydrocyclohepta[b]indole

CAS: 2047-89-4

5,6,7,8,9,10-Hexahydrocyclohepta[b]indole

Purity: 99%

Molecular weight: 185.27g/mol

Ref: 54-OR74662

5,6,7,8,9,10-Hexahydrocyclohepta[b]indole

CAS: 2047-89-4

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 185.27000427246094

Ref: 10-F544308