CymitQuimica logo

CAS 204715-91-3

:

Fmoc-L-4-aminomethylphe(Boc)

Description:
Fmoc-L-4-aminomethylphenyl(Boc) is a chemical compound commonly used in peptide synthesis and drug development. It features a protected amino acid structure, where the Fmoc (9-fluorenylmethoxycarbonyl) group serves as a protective moiety for the amine, allowing for selective reactions without interfering with the amino functionality. The Boc (tert-butyloxycarbonyl) group also acts as a protective group for the amine, enhancing stability and solubility during synthesis. This compound is characterized by its aromatic ring, which contributes to its hydrophobic properties, and the presence of an amino group that can participate in various chemical reactions, including coupling reactions in peptide synthesis. Its molecular structure allows for the introduction of further functional groups, making it versatile in synthetic chemistry. The compound is typically handled under controlled conditions due to its reactivity and potential hazards associated with its components. Overall, Fmoc-L-4-aminomethylphenyl(Boc) is an important intermediate in the field of organic and medicinal chemistry.
Formula:C30H32N2O6
InChI:InChI=1/C30H32N2O6/c1-30(2,3)38-28(35)31-17-20-14-12-19(13-15-20)16-26(27(33)34)32-29(36)37-18-25-23-10-6-4-8-21(23)22-9-5-7-11-24(22)25/h4-15,25-26H,16-18H2,1-3H3,(H,31,35)(H,32,36)(H,33,34)/t26-/m0/s1
InChI key:QSPDPKLGXGMDAY-SANMLTNESA-N
SMILES:CC(C)(C)OC(=O)NCC1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24
Synonyms:
  • 4-{[(tert-butoxycarbonyl)amino]methyl}-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-phenylalanine
  • Fmoc-4-(Boc-aminomethyl)-L-phenylalanine
  • Fmoc-D, L-Phe(4-Ch2Nh-Boc)
Found 5 products.