CAS 20478-70-0

decanehydrazide

Description:

Decanehydrazide, with the CAS number 20478-70-0, is an organic compound characterized by its hydrazide functional group attached to a decane chain. It typically appears as a white to off-white solid and is soluble in polar organic solvents. The compound is known for its stability under normal conditions, but it may decompose upon exposure to strong acids or bases. Decanehydrazide can participate in various chemical reactions, including acylation and condensation, making it useful in organic synthesis and as a building block for more complex molecules. Its hydrazide functionality allows it to form hydrazones with carbonyl compounds, which can be utilized in various applications, including pharmaceuticals and agrochemicals. Additionally, due to its relatively long hydrocarbon chain, decanehydrazide may exhibit surfactant properties, influencing its behavior in mixtures with other substances. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₀H₂₂N₂O

InChI: InChI=1/C10H22N2O/c1-2-3-4-5-6-7-8-9-10(13)12-11/h2-9,11H2,1H3,(H,12,13)

Synonyms:

• Decanoic Acid, Hydrazide

Decanohydrazide

CAS: 20478-70-0

Formula: C₁₀H₂₂N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 186.2945

Ref: IN-DA0029OY

Decanehydrazide

CAS: 20478-70-0

Decanehydrazide

Purity: 97%

Molecular weight: 186.29g/mol

Ref: 54-OR1012777

Decanoic acid, hydrazide

CAS: 20478-70-0

Decanoic acid, hydrazide is a biochemical.

Formula: C₁₀H₂₂N₂O

Color and Shape: Solid

Molecular weight: 186.29

Ref: TM-T31346

decanohydrazide

CAS: 20478-70-0

Formula: C₁₀H₂₂N₂O

Purity: 98%

Molecular weight: 186.299

Ref: 10-F364751