CAS 204841-19-0
:3-Acetylbenzeneboronic acid
Description:
3-Acetylbenzeneboronic acid is an organoboron compound characterized by the presence of both a boronic acid functional group and an acetyl group attached to a benzene ring. Its molecular structure features a boron atom bonded to a hydroxyl group and an aryl group, which in this case is a substituted phenyl ring with an acetyl group at the meta position. This compound is typically a white to off-white solid and is soluble in polar organic solvents. It is known for its utility in organic synthesis, particularly in cross-coupling reactions such as Suzuki-Miyaura coupling, where it serves as a boron source for the formation of carbon-carbon bonds. Additionally, 3-acetylbenzeneboronic acid can act as a ligand in coordination chemistry and has potential applications in medicinal chemistry due to its ability to interact with biological targets. Safety data should be consulted for handling, as boronic acids can be sensitive to moisture and may require specific storage conditions.
Formula:C8H9BO3
InChI:InChI=1/C8H9BO3/c1-6(10)7-3-2-4-8(5-7)9(11)12/h2-5,11-12H,1H3
SMILES:CC(=O)c1cccc(c1)B(O)O
Synonyms:- 3-Acetylphenylboronic acid
- 3-Boronoacetophenone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
3-Acetylbenzeneboronic acid, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C8H9BO3Purity:97%Color and Shape:Powder, White to pale cream to pale yellowMolecular weight:163.97Boronic acid, B-(3-acetylphenyl)-
CAS:Formula:C8H9BO3Purity:97%Color and Shape:SolidMolecular weight:163.96633-Acetylbenzeneboronic acid
CAS:3-Acetylbenzeneboronic acidFormula:C8H9BO3Purity:≥95%Color and Shape: off white solidMolecular weight:163.97g/mol3-Acetylphenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C8H9BO3Color and Shape:White to Yellow powder to crystalMolecular weight:163.973-Acetylphenylboronic acid
CAS:<p>3-Acetylphenylboronic acid is a functional group with an acetyl group substituted for the hydroxyl group of phenol. 3-Acetylphenylboronic acid has been shown to inhibit cholinesterase through competitive inhibition. It also binds to the endocannabinoid receptor CB1 and competes with anandamide, which is a natural ligand of this receptor. 3-Acetylphenylboronic acid may be used as a replacement for fatty acids in carbon nanotubes because it has the same basic structure but does not react with oxygen or other chemicals. 3-Acetylphenylboronic acid also reacts with metal ions such as copper and zinc, which may be due to its electron withdrawing ability.</p>Formula:C8H9BO3Purity:Min. 98 Area-%Color and Shape:White Slightly Yellow PowderMolecular weight:163.97 g/mol3-Acetylphenylboronic acid
CAS:Controlled Product<p>Applications 3-Acetylphenylboronic acid<br></p>Formula:C8H9BO3Color and Shape:NeatMolecular weight:163.97
