CAS 20485-22-7: Butanoic acid, 1-methyl-1H-indol-3-yl ester
Description:Butanoic acid, 1-methyl-1H-indol-3-yl ester, also known by its CAS number 20485-22-7, is an organic compound characterized by the presence of both a butanoic acid moiety and an indole derivative. This compound features a butanoate functional group, which contributes to its carboxylic acid properties, while the indole structure provides aromatic characteristics and potential biological activity. Typically, esters like this one are formed through the reaction of an alcohol and a carboxylic acid, resulting in a compound that may exhibit unique solubility and reactivity profiles. The presence of the indole ring suggests potential applications in pharmaceuticals, as indole derivatives are often associated with various biological activities, including antimicrobial and anti-inflammatory effects. Additionally, the compound's molecular structure may influence its physical properties, such as boiling point and melting point, as well as its behavior in biological systems. Overall, Butanoic acid, 1-methyl-1H-indol-3-yl ester represents a class of compounds that may be of interest in both synthetic chemistry and medicinal research.
Formula:C13H15NO2
InChI:InChI=1S/C13H15NO2/c1-3-6-13(15)16-12-9-14(2)11-8-5-4-7-10(11)12/h4-5,7-9H,3,6H2,1-2H3
InChI key:InChIKey=JVYIBVQFERSMOP-UHFFFAOYSA-N
SMILES:O=C(OC1=CN(C=2C=CC=CC12)C)CCC
- Synonyms:
- Butanoic acid, 1-methyl-1H-indol-3-yl ester
- N-Methylindoxyl butyrate
- Butyric acid, 1-methylindol-3-yl ester
- Indol-3-ol, 1-methyl-, butyrate (ester)
- 1-Methyl-1H-indol-3-yl butyrate
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | Butanoic acid, 1-methyl-1H-indol-3-yl ester REF: IN-DA0029QECAS: 20485-22-7 | - - - | To inquire | Thu 17 Apr 25 |
 | 1-Methyl-1H-indol-3-yl butyrate REF: 10-F750512CAS: 20485-22-7 | 95+% | To inquire | Tue 29 Apr 25 |
 | 1-Methyl-1H-indol-3-yl butyrate REF: 3D-VAA48522CAS: 20485-22-7 | Min. 95% | - - - | Discontinued product |
Ref: IN-DA0029QE
| Undefined size | To inquire |
Ref: 10-F750512
| 1g | To inquire | ||
| 250mg | To inquire |
1-Methyl-1H-indol-3-yl butyrate
Ref: 3D-VAA48522
| 10mg | Discontinued | Request information | |
| 25mg | Discontinued | Request information | |
| 50mg | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information |
