CAS 204853-33-8
:(3S,4S,5S,6S)-3,4,5-trihydroxy-6-[2-hydroxy-5-(4-methylbenzoyl)-3-nitro-phenoxy]tetrahydropyran-2-carboxylic acid
Description:
The chemical substance known as "(3S,4S,5S,6S)-3,4,5-trihydroxy-6-[2-hydroxy-5-(4-methylbenzoyl)-3-nitro-phenoxy]tetrahydropyran-2-carboxylic acid," with the CAS number 204853-33-8, is a complex organic compound characterized by its tetrahydropyran ring structure, which features multiple hydroxyl groups that contribute to its hydrophilicity and potential for forming hydrogen bonds. The presence of a carboxylic acid functional group indicates acidic properties, while the nitro and benzoyl substituents suggest potential for biological activity and interactions with various biological targets. This compound may exhibit solubility in polar solvents due to its hydroxyl groups and could participate in various chemical reactions, including esterification and nucleophilic substitutions. Its stereochemistry, indicated by the (3S,4S,5S,6S) configuration, suggests specific spatial arrangements that may influence its biological activity and interactions. Overall, this compound's unique structure and functional groups make it of interest in medicinal chemistry and pharmacology, potentially serving as a lead compound for drug development.
Formula:C20H19NO11
InChI:InChI=1/C20H19NO11/c1-8-2-4-9(5-3-8)13(22)10-6-11(21(29)30)14(23)12(7-10)31-20-17(26)15(24)16(25)18(32-20)19(27)28/h2-7,15-18,20,23-26H,1H3,(H,27,28)/t15-,16-,17-,18?,20+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Ro 61-1448
CAS:Ro 61-1448 is a metabolite of tolcapone, a catechol-O-methyltransferase inhibitor.Formula:C20H19NO11Purity:98%Color and Shape:SolidMolecular weight:449.36Tolcapone 3-β-D-Glucuronide
CAS:Formula:C20H19NO11Color and Shape:Pale Yellow SolidMolecular weight:449.37Tolcapone 3-O-β-D-glucuronide
CAS:Tolcapone 3-O-β-D-glucuronidePurity:>95%Molecular weight:449.36g/molTolcapone 3-β-D-Glucuronide
CAS:Controlled ProductApplications A metabolite of Tolcapone (T535250).002
References Wikberg, T., et al.: Drug Metab. Dispos., 21, 81 (1993), Jorga, K., et al.: Clin. Pharmacol. Ther., 62, 300 (1997), Kurth, M., et al.: Neurology, 48, 81 (1997),Formula:C20H19NO11Color and Shape:NeatMolecular weight:449.36





