CAS 20486-33-3
:3-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxo-4H-chromen-7-yl (3xi)-beta-D-ribo-hexopyranoside
Description:
3-(3,4-Dihydroxyphenyl)-5-hydroxy-4-oxo-4H-chromen-7-yl (3xi)-beta-D-ribo-hexopyranoside, with CAS number 20486-33-3, is a glycosylated flavonoid compound. This substance features a chromen-4-one backbone, which is characteristic of flavonoids, and is substituted with multiple hydroxyl groups that contribute to its potential antioxidant properties. The presence of the beta-D-ribo-hexopyranoside moiety indicates that it is a glycoside, which may influence its solubility and biological activity. Such compounds are often studied for their pharmacological effects, including anti-inflammatory and anticancer activities. The structural complexity, including the arrangement of hydroxyl groups and the sugar moiety, can significantly affect its interaction with biological systems. Additionally, the compound may exhibit varying degrees of stability and reactivity depending on environmental conditions, such as pH and temperature. Overall, this substance represents a class of natural products that are of interest in medicinal chemistry and pharmacognosy.
Formula:C21H20O11
InChI:InChI=1/C21H20O11/c22-6-15-18(27)19(28)20(29)21(32-15)31-9-4-13(25)16-14(5-9)30-7-10(17(16)26)8-1-2-11(23)12(24)3-8/h1-5,7,15,18-25,27-29H,6H2/t15-,18-,19?,20-,21-/m1/s1
SMILES:c1cc(c(cc1c1coc2cc(cc(c2c1=O)O)O[C@H]1[C@@H](C([C@@H]([C@@H](CO)O1)O)O)O)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Orobol 7-O-glucoside
CAS:Orobol 7-O-glucoside is a flavonoid glucoside, which is a type of phenolic compound widely studied in the scientific community for its potential biological activities. It is derived from natural plant sources, particularly legumes, where it occurs as a conjugate of the isoflavone orobol. The mode of action of Orobol 7-O-glucoside involves its ability to scavenge free radicals, providing potent antioxidant effects. This compound exhibits the ability to modulate signaling pathways relevant to oxidative stress and inflammation, suggesting possible therapeutic roles in related disorders.Formula:C21H20O11Purity:Min. 95%Color and Shape:PowderMolecular weight:448.38 g/mol
