CAS 20491-92-3
:2,4,6-Trimethoxyphenol
Description:
2,4,6-Trimethoxyphenol, with the CAS number 20491-92-3, is an organic compound characterized by the presence of three methoxy (-OCH3) groups attached to a phenolic ring. This compound is a derivative of phenol, where the methoxy groups are positioned at the 2, 4, and 6 positions, contributing to its unique chemical properties. It typically appears as a white to off-white solid and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water due to its hydrophobic nature. 2,4,6-Trimethoxyphenol exhibits antioxidant properties and is often studied for its potential applications in pharmaceuticals, cosmetics, and as a chemical intermediate. Its structure allows for various chemical reactions, including methylation and oxidation, making it a versatile compound in organic synthesis. Additionally, it may exhibit biological activity, which has prompted research into its effects on human health and its potential therapeutic uses. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C9H12O4
InChI:InChI=1S/C9H12O4/c1-11-6-4-7(12-2)9(10)8(5-6)13-3/h4-5,10H,1-3H3
InChI key:InChIKey=HSJYYLNJWGKZMD-UHFFFAOYSA-N
SMILES:O(C)C1=C(O)C(OC)=CC(OC)=C1
Synonyms:- 2,4,6-Trimethoxyphenol
- 2,4,6-Trimethoxylphenol
- Phenol, 2,4,6-trimethoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Phenol, 2,4,6-trimethoxy-
CAS:Formula:C9H12O4Purity:97%Color and Shape:SolidMolecular weight:184.18922,4,6-Trimethoxyphenol
CAS:2,4,6-TrimethoxyphenolFormula:C9H12O4Purity:97%Color and Shape: light brown powderMolecular weight:184.19g/mol2,4,6-Trimethoxyphenol
CAS:2,4,6-Trimethoxyphenol is a synthetic molecule that has been shown to have antioxidant effects in vitro and in vivo. It is also able to increase insulin sensitivity and lower blood pressure in diabetic patients. 2,4,6-Trimethoxyphenol is an inhibitor of the enzyme catechol-O-methyltransferase (COMT), which degrades catecholamines such as dopamine and norepinephrine. It has been shown to inhibit the oxidation of these molecules by reacting with hydrogen peroxide to produce H2O2. The demethylation of 2,4,6-trimethoxyphenol produces 3,4,5-trimethoxybenzyl alcohol (3MBA), which can be used for the treatment of diabetes mellitus type II.Formula:C9H12O4Purity:Min. 95%Color and Shape:PowderMolecular weight:184.19 g/mol2,4,6-Trimethoxyphenol
CAS:Formula:C9H12O4Purity:95%Color and Shape:No data available.Molecular weight:184.191




