CymitQuimica logo

CAS 20493-60-1

:

5-Bromo-3-methylisothiazole

Description:
5-Bromo-3-methylisothiazole is a heterocyclic organic compound characterized by its isothiazole ring structure, which contains both sulfur and nitrogen atoms. This compound features a bromine atom and a methyl group attached to the isothiazole ring, contributing to its unique chemical properties. It is typically a colorless to pale yellow solid with a distinct odor. The presence of the bromine atom enhances its reactivity, making it useful in various chemical syntheses and applications, particularly in the field of agrochemicals and pharmaceuticals. 5-Bromo-3-methylisothiazole is known for its antimicrobial and antifungal properties, which make it valuable in the development of biocides and preservatives. Additionally, it is soluble in organic solvents, which facilitates its use in various formulations. Safety data indicates that, like many halogenated compounds, it should be handled with care due to potential toxicity and environmental impact. Overall, this compound is significant in both industrial and research contexts due to its versatile chemical behavior.
Formula:C4H4BrNS
InChI:InChI=1S/C4H4BrNS/c1-3-2-4(5)7-6-3/h2H,1H3
InChI key:InChIKey=XSVSPKKXQGNHMD-UHFFFAOYSA-N
SMILES:CC=1C=C(Br)SN1
Synonyms:
  • 5-Bromo-3-methylisothiazole
  • Isothiazole, 5-Bromo-3-Methyl-
Found 5 products.