CAS 20495-99-2

Formula: C6H8Cl2O3

InChI: InChI=1S/C6H8Cl2O3/c7-3-1-5(9)11-6(10)2-4-8/h1-4H2

InChI key: UQNMBHOXSQYAAC-UHFFFAOYSA-N

SMILES: C(CCl)C(=O)OC(=O)CCCl

3-Chloropropanoic anhydride

CAS: 20495-99-2

3-Chloropropanoic anhydride

Formula: C₆H₈Cl₂O₃

Purity: 95%

Molecular weight: 199.03

Ref: 54-OR86059

3-Chloropropanoic Anhydride

CAS: 20495-99-2

Formula: C₆H₈Cl₂O₃

Purity: 95%

Molecular weight: 199.0319

Ref: IN-DA01FFF1

3-Chloropropanoic Anhydride

CAS: 20495-99-2

Formula: C₆H₈Cl₂O₃

Molecular weight: 199.03

Ref: 4Z-P-180017

3-Chloropropionic anhydride

CAS: 20495-99-2

3-Chloropropionic anhydride (3CP) is a reagent that contains the carboxylic acid group. It is used for esterification reactions, such as in the synthesis of succinimidyl 3-chloropropionate, which is used for peptide coupling. 3CP is also used to synthesize activated esters, such as N-succinimidyl 3-chloropropionate and N-succinimidyl 4-(maleimido)butyrate. The compound has been shown to react with carboxylic acids to form an anhydride. The reaction of 3CP with isovalerate forms the corresponding isovaleramide analogues.

Formula: C₆H₈Cl₂O₃

Purity: Min. 95%

Color and Shape: Clear Liquid

Molecular weight: 199.03 g/mol

Ref: 3D-FC170943

3-Chloropropanoic anhydride

CAS: 20495-99-2

Purity: 95%

Color and Shape: Solid

Molecular weight: 199.0299988

Ref: 10-F733140

3-Chloropropanoic anhydride

CAS: 20495-99-2

3-Chloropropanoic anhydride

Formula: C₆H₈Cl₂O₃

Purity: 95%

Molecular weight: 199.03

Ref: IN-DG01186111