CAS 20497-90-9

1-(1-adamantyl)-4-methylpyridinium bromide

Description:

1-(1-Adamantyl)-4-methylpyridinium bromide is a quaternary ammonium salt characterized by its unique structure, which includes a pyridine ring substituted with an adamantyl group and a methyl group. This compound typically appears as a white to off-white crystalline solid. It is soluble in polar solvents such as water and methanol, which is a common trait for quaternary ammonium salts due to their ionic nature. The presence of the adamantyl group contributes to its hydrophobic characteristics, while the pyridinium moiety enhances its solubility in polar environments. This compound is often studied for its potential applications in organic synthesis, as a phase transfer catalyst, and in various biochemical contexts due to its ability to interact with biological membranes. Additionally, its bromide counterion can influence its reactivity and solubility. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.

Formula: C₁₆H₂₂BrN

InChI: InChI=1/C16H22N.BrH/c1-12-2-4-17(5-3-12)16-9-13-6-14(10-16)8-15(7-13)11-16;/h2-5,13-15H,6-11H2,1H3;1H/q+1;/p-1

Synonyms:

• 4-Methyl-1-Tricyclo[3.3.1.1~3,7~]Dec-1-Ylpyridinium Bromide

1-(1-adamantyl)-4-methylpyridinium bromide

CAS: 20497-90-9

1-(1-adamantyl)-4-methylpyridinium bromide

Purity: ≥95%

Molecular weight: 308.26g/mol

Ref: 54-OR24576

1-(1-Adamantyl)-4-methylpyridinium Bromide

Controlled Product

CAS: 20497-90-9

Formula: C₁₆H₂₂N·Br

Color and Shape: Neat

Molecular weight: 308.257

Ref: TR-A433080