
CAS 204970-97-8
:4-[[(1S)-2-[(3S)-3-Hydroxy-1-pyrrolidinyl]-1-phenylethyl]methylamino]-N-propylbenzamide
Description:
4-[[(1S)-2-[(3S)-3-Hydroxy-1-pyrrolidinyl]-1-phenylethyl]methylamino]-N-propylbenzamide, with the CAS number 204970-97-8, is a chemical compound that belongs to the class of benzamides. This substance features a complex structure characterized by a benzamide core, which is substituted with a propyl group and a methylamino group. The presence of a pyrrolidine ring and a hydroxyl group contributes to its potential biological activity, suggesting interactions with various biological targets. The stereochemistry indicated by the (1S) and (3S) designations suggests specific spatial arrangements of atoms, which can significantly influence the compound's pharmacological properties. Such compounds are often studied for their potential therapeutic applications, particularly in the fields of neuroscience and psychiatry, due to their ability to modulate neurotransmitter systems. As with many organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions, making it essential for researchers to consider these factors during experimentation and application.
Formula:C23H31N3O2
InChI:InChI=1S/C23H31N3O2/c1-3-14-24-23(28)19-9-11-20(12-10-19)25(2)22(18-7-5-4-6-8-18)17-26-15-13-21(27)16-26/h4-12,21-22,27H,3,13-17H2,1-2H3,(H,24,28)/t21-,22+/m0/s1
InChI key:InChIKey=FHFHNAQEPILWDK-FCHUYYIVSA-N
SMILES:[C@@H](N(C)C1=CC=C(C(NCCC)=O)C=C1)(CN2C[C@@H](O)CC2)C3=CC=CC=C3
Synonyms:- Benzamide, 4-[[2-(3-hydroxy-1-pyrrolidinyl)-1-phenylethyl]methylamino]-N-propyl-, [S-(R*,R*)]-
- CJ 15161
- Benzamide, 4-[[(1S)-2-[(3S)-3-hydroxy-1-pyrrolidinyl]-1-phenylethyl]methylamino]-N-propyl-
- 4-[[(1S)-2-[(3S)-3-Hydroxy-1-pyrrolidinyl]-1-phenylethyl]methylamino]-N-propylbenzamide
- CJ-15,161
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
CJ-15161 (free base)
CAS:CJ-15161 (free base), an opioid κ-receptor agonist, is undergoing development with Pfizer as an analgesic agent.Formula:C23H31N3O2Color and Shape:SolidMolecular weight:381.51
