CAS 204992-09-6
:4-hydroxy-L-prolyl-N~5~-(diaminomethylidene)-L-ornithylglycyl-N-[(2S)-2-amino-3-(4-fluorophenyl)propanoyl]-L-tryptophanamide bis(trifluoroacetate) (salt)
Description:
4-Hydroxy-L-prolyl-N~5~-(diaminomethylidene)-L-ornithylglycyl-N-[(2S)-2-amino-3-(4-fluorophenyl)propanoyl]-L-tryptophanamide bis(trifluoroacetate) is a complex peptide derivative characterized by its intricate structure, which includes multiple amino acid residues and functional groups. This compound features a hydroxyproline unit, which contributes to its potential biological activity, particularly in peptide synthesis and protein interactions. The presence of the diaminomethylidene group suggests potential reactivity and interaction with biological targets, while the fluorophenyl moiety may enhance lipophilicity and influence pharmacokinetics. The bis(trifluoroacetate) salt form indicates that the compound is likely to be more soluble in polar solvents, which can be advantageous for various applications in medicinal chemistry and drug formulation. Overall, this substance may exhibit interesting pharmacological properties, making it a candidate for further research in therapeutic contexts, particularly in areas related to peptide-based drugs and bioactive compounds.
Formula:C37H45F7N10O10
InChI:InChI=1/C33H43FN10O6.2C2HF3O2/c34-20-9-7-18(8-10-20)12-23(35)29(47)44-32(50)27(13-19-15-39-24-5-2-1-4-22(19)24)42-28(46)17-41-30(48)25(6-3-11-38-33(36)37)43-31(49)26-14-21(45)16-40-26;2*3-2(4,5)1(6)7/h1-2,4-5,7-10,15,21,23,25-27,39-40,45H,3,6,11-14,16-17,35H2,(H,41,48)(H,42,46)(H,43,49)(H4,36,37,38)(H,44,47,50);2*(H,6,7)/t21?,23-,25-,26-,27-;;/m0../s1
SMILES:c1ccc2c(c1)c(C[C@@H](C(=O)N=C([C@H](Cc1ccc(cc1)F)N)O)N=C(CN=C([C@H](CCCNC(=N)N)N=C([C@@H]1CC(CN1)O)O)O)O)c[nH]2.C(=O)(C(F)(F)F)O.C(=O)(C(F)(F)F)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Nemifitide diTFA
CAS:Nemifitide diTFA is a synthetic pentapeptide with antidepressant properties, resembling MIF, that crosses the blood-brain barrier.Formula:C37H45F7N10O10Purity:99.78% - 99.84%Color and Shape:SolidMolecular weight:922.8Nemifitide
CAS:Nemifitide is a peptide that belongs to the inhibitor class of ligands. It binds to and blocks the action of ion channels, which are membrane proteins that allow ions to flow across a cell's membrane. Nemifitide specifically inhibits the Nav1.8 channel, which is involved in pain perception. Nemifitide has been shown to inhibit Nav1.8 channels with high affinity and selectivity, making it a useful research tool for studying ion channel function and developing new medications for pain treatment. Nemifitide has also been used as an effective antibody against the receptor protein, P2X7R.
Formula:C37H45F7N10O10Purity:Min. 95%Molecular weight:922.8 g/mol


