CAS 2050-25-1
:di(ethylene glycol) benzyl ether
Description:
Di(ethylene glycol) benzyl ether, with the CAS number 2050-25-1, is an organic compound characterized by its ether functional group and the presence of a benzyl moiety. It is a colorless to pale yellow liquid that is typically viscous and has a mild aromatic odor. This compound is known for its excellent solubility in various organic solvents, making it useful as a solvent and a coupling agent in formulations. It exhibits low volatility and a relatively high boiling point, which contributes to its stability under various conditions. Di(ethylene glycol) benzyl ether is often utilized in the production of coatings, adhesives, and inks, as well as in the formulation of personal care products due to its emulsifying properties. Additionally, it has a low toxicity profile, which enhances its appeal for applications in consumer products. Its chemical structure allows for hydrogen bonding, which can influence its physical properties and interactions with other substances. Overall, di(ethylene glycol) benzyl ether is valued for its versatility and effectiveness in various industrial applications.
Formula:C11H16O3
InChI:InChI=1/C11H16O3/c12-6-7-13-8-9-14-10-11-4-2-1-3-5-11/h1-5,12H,6-10H2
SMILES:c1ccc(cc1)COCCOCCO
Synonyms:- Diethylene Glycol Monobenzyl Ether
- Bn-PEG2-OH
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Diethylene Glycol Monobenzyl Ether
CAS:Formula:C11H16O3Purity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:196.25Ethanol, 2-[2-(phenylmethoxy)ethoxy]-
CAS:Formula:C11H16O3Purity:97%Color and Shape:LiquidMolecular weight:196.2429Ref: IN-DA0029T9
1kg115.00€25g20.00€50g28.00€100g28.00€250g50.00€25kgTo inquire500g73.00€50kgTo inquire2-[2-(Benzyloxy)ethoxy]ethanol
CAS:2-[2-(Benzyloxy)ethoxy]ethanolPurity:98%Color and Shape:Pale Yellow LiquidMolecular weight:196.24g/molDiethylene Glycol Monobenzyl Ether
CAS:Diethylene Glycol Monobenzyl Ether: PEG linker for creating PROTACs enabling targeted protein degradation.Formula:C11H16O3Color and Shape:SolidMolecular weight:196.242-(2-(Benzyloxy)ethoxy)ethanol
CAS:Formula:C11H16O3Purity:97%Color and Shape:ClearMolecular weight:196.246




