CAS 20500-29-2
:2-(2-deoxypentofuranosyl)-1,2,4-triazine-3,5(2H,4H)-dione
Description:
2-(2-Deoxypentofuranosyl)-1,2,4-triazine-3,5(2H,4H)-dione, with the CAS number 20500-29-2, is a chemical compound that belongs to the class of triazines, which are heterocyclic compounds containing three nitrogen atoms in a six-membered ring. This particular compound features a deoxypentofuranosyl moiety, indicating that it is a nucleoside derivative, which is significant in the context of nucleic acids and their analogs. The presence of the triazine ring contributes to its potential biological activity, as triazines are known for their roles in various biochemical processes. The compound is characterized by its ability to form hydrogen bonds due to the presence of carbonyl groups, which may influence its interaction with biological macromolecules. Additionally, its structural features suggest potential applications in medicinal chemistry, particularly in the development of antiviral or anticancer agents. However, specific properties such as solubility, stability, and reactivity would depend on the conditions under which the compound is studied.
Formula:C8H11N3O5
InChI:InChI=1S/C8H11N3O5/c12-3-5-4(13)1-7(16-5)11-8(15)10-6(14)2-9-11/h2,4-5,7,12-13H,1,3H2,(H,10,14,15)/t4-,5+,7+/m0/s1
InChI key:InChIKey=MDYXMIBUOJQPHR-HBPOCXIASA-N
SMILES:O=C1N([C@@H]2O[C@H](CO)[C@@H](O)C2)N=CC(=O)N1
Synonyms:- NSC 101589
- 2-(2-Deoxy-β-D-erythro-pentofuranosyl)-1,2,4-triazine-3,5(2H,4H)-dione
- as-Triazine-3,5(2H,4H)-dione, 2-(2-deoxy-β-D-erythro-pentofuranosyl)-
- 2′-Deoxy-6-azauridine
- 1,2,4-Triazine-3,5(2H,4H)-dione, 2-(2-deoxy-β-D-erythro-pentofuranosyl)-
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2'-Deoxy-6-azauridine
CAS:2’-Deoxy-6-azauridine is a useful organic compound for research related to life sciences. The catalog number is TNU1081 and the CAS number is 20500-29-2.Formula:C8H11N3O5Color and Shape:SolidMolecular weight:229.19
