CAS 205055-71-6

2-chloroquinoline-6-sulfonyl chloride

Description:

2-Chloroquinoline-6-sulfonyl chloride is an organic compound characterized by its sulfonyl chloride functional group attached to a quinoline ring system. This compound typically appears as a solid or crystalline substance and is known for its reactivity due to the presence of the sulfonyl chloride group, which can participate in various nucleophilic substitution reactions. It is often utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to act as a sulfonylating agent. The chlorine atom in the 2-position of the quinoline ring enhances its electrophilic character, making it a valuable intermediate in the synthesis of more complex molecules. Additionally, the compound may exhibit specific solubility characteristics, often being soluble in organic solvents while having limited solubility in water. Safety precautions are necessary when handling this compound, as sulfonyl chlorides can be corrosive and may release toxic gases upon reaction with water or moisture.

Formula: C₉H₅Cl₂NO₂S

InChI: InChI=1/C9H5Cl2NO2S/c10-9-4-1-6-5-7(15(11,13)14)2-3-8(6)12-9/h1-5H

SMILES: c1cc(Cl)nc2ccc(cc12)S(=O)(=O)Cl

Synonyms:

• 2-Chloroquinoline-6-sulfonyl Chloride

6-Quinolinesulfonyl chloride, 2-chloro-

CAS: 205055-71-6

Formula: C₉H₅Cl₂NO₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 262.1125

Ref: IN-DA0029U7

2-Chloroquinoline-6-sulfonyl chloride

CAS: 205055-71-6

2-Chloroquinoline-6-sulfonyl chloride

Purity: 98%

Molecular weight: 262.12g/mol

Ref: 54-OR1074130

2-Chloroquinoline-6-sulfonyl Chloride

Controlled Product

CAS: 205055-71-6

Formula: C₉H₅Cl₂NO₂S

Color and Shape: Neat

Molecular weight: 262.11

Ref: TR-C381240