CAS 2051-53-8
:Methylisopropylaniline
Description:
Methylisopropylaniline, with the CAS number 2051-53-8, is an organic compound that belongs to the class of anilines, which are characterized by the presence of an amino group attached to an aromatic ring. This compound features a methyl group and an isopropyl group attached to the nitrogen of the aniline structure, contributing to its unique properties. Methylisopropylaniline is typically a colorless to pale yellow liquid with a characteristic amine odor. It is moderately soluble in water and more soluble in organic solvents, reflecting its hydrophobic nature due to the alkyl substituents. The compound is primarily used in the synthesis of dyes, pharmaceuticals, and agrochemicals. It exhibits basic properties due to the presence of the amino group, allowing it to participate in various chemical reactions, including alkylation and acylation. Safety precautions are necessary when handling this substance, as it can be harmful if inhaled or absorbed through the skin, and it may cause irritation to the eyes and respiratory system.
Formula:C10H15N
InChI:InChI=1/C10H15N/c1-7(2)9-5-4-8(3)10(11)6-9/h4-7H,11H2,1-3H3
SMILES:CC(C)c1ccc(C)c(c1)N
Synonyms:- 2-Methyl-5-isopropylaniline
- 3-[Nitroso(Prop-2-En-1-Yl)Amino]Propane-1,2-Diol
- 5-Isopropyl-2-Methyl-Aniline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Methyl-5-isopropylaniline
CAS:Formula:C10H15NPurity:>93.0%(GC)Color and Shape:Colorless to Yellow clear liquidMolecular weight:149.24Benzenamine, 2-methyl-5-(1-methylethyl)-
CAS:Formula:C10H15NPurity:98%Color and Shape:LiquidMolecular weight:149.23282-Methyl-5-isopropylaniline
CAS:2-Methyl-5-isopropylanilineFormula:C10H15NPurity:≥95%Color and Shape: clear. very dark red liquidMolecular weight:149.2328g/mol5-Isopropyl-2-methylaniline
CAS:Formula:C10H15NPurity:98%Color and Shape:LiquidMolecular weight:149.2372-Methyl-5-isopropylaniline
CAS:2-Methyl-5-isopropylaniline is a chemical that has been shown to have an antiproliferative effect, inducing cell apoptosis. It has also been shown to inhibit the growth of tumor cells by inducing cell death in human fibroblasts and colorectal carcinoma cells. The mechanism of action appears to be due to 2-methyl-5-isopropylaniline binding to DNA. This binding inhibits the synthesis of RNA and protein, inhibiting cancer cell proliferation. 2-Methyl-5-isopropylaniline has also been shown to induce DNA strand breaks and inhibit the repair process, which leads to rapid cellular death.
Formula:C10H15NPurity:Min. 95%Molecular weight:149.24 g/mol




